C15H32NO+ — CID 4226766
trimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyethyl]azanium (PubChem CID 4226766) has the molecular formula C15H32NO+ and a molecular weight of 242.43 g/mol. Its IUPAC name is trimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyethyl]azanium.
| Compound Name | trimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyethyl]azanium |
|---|---|
| PubChem CID | 4226766 |
| Molecular Formula | C15H32NO+ |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | trimethyl-[2-(5-methyl-2-propan-2-ylcyclohexyl)oxyethyl]azanium |
| SMILES | CC1CCC(C(C)C)C(OCC[N+](C)(C)C)C1 |
| InChI | InChI=1S/C15H32NO/c1-12(2)14-8-7-13(3)11-15(14)17-10-9-16(4,5)6/h12-15H,7-11H2,1-6H3/q+1 |
| InChIKey | XLHNIVJJGBTURC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|