C17H17ClFN5OS — CID 42274035
1-[2-[(2-chloro-6-fluorophenyl)methylamino]ethyl]-N-(thiophen-2-ylmethyl)triazole-4-carboxamide (PubChem CID 42274035) has the molecular formula C17H17ClFN5OS and a molecular weight of 393.88 g/mol. Its IUPAC name is 1-[2-[(2-chloro-6-fluorophenyl)methylamino]ethyl]-N-(thiophen-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-[2-[(2-chloro-6-fluorophenyl)methylamino]ethyl]-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 42274035 |
| Molecular Formula | C17H17ClFN5OS |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 1-[2-[(2-chloro-6-fluorophenyl)methylamino]ethyl]-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cn(CCNCc2c(F)cccc2Cl)nn1 |
| InChI | InChI=1S/C17H17ClFN5OS/c18-14-4-1-5-15(19)13(14)10-20-6-7-24-11-16(22-23-24)17(25)21-9-12-3-2-8-26-12/h1-5,8,11,20H,6-7,9-10H2,(H,21,25) |
| InChIKey | SEOKAQCDKPSBGD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|