C21H22ClN5O3 — CID 26402089
1-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-N-(2-phenylethyl)triazole-4-carboxamide (PubChem CID 26402089) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is 1-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-N-(2-phenylethyl)triazole-4-carboxamide.
| Compound Name | 1-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-N-(2-phenylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 26402089 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-N-(2-phenylethyl)triazole-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cn(CCNCc2cc3c(cc2Cl)OCO3)nn1 |
| InChI | InChI=1S/C21H22ClN5O3/c22-17-11-20-19(29-14-30-20)10-16(17)12-23-8-9-27-13-18(25-26-27)21(28)24-7-6-15-4-2-1-3-5-15/h1-5,10-11,13,23H,6-9,12,14H2,(H,24,28) |
| InChIKey | IQEXXVPXVGHPGW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|