C13H14N4O4 — CID 103243079
1-[2-(1,3-benzodioxol-4-ylmethylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 103243079) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-4-ylmethylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(1,3-benzodioxol-4-ylmethylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103243079 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-4-ylmethylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCNCc2cccc3c2OCO3)nn1 |
| InChI | InChI=1S/C13H14N4O4/c18-13(19)10-7-17(16-15-10)5-4-14-6-9-2-1-3-11-12(9)21-8-20-11/h1-3,7,14H,4-6,8H2,(H,18,19) |
| InChIKey | AEMAPRJVPOKWHG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|