C11H15N5O3 — CID 103255652
1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]triazole-4-carboxylic acid (PubChem CID 103255652) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103255652 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethyl]triazole-4-carboxylic acid |
| SMILES | Cc1noc(C)c1CNCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H15N5O3/c1-7-9(8(2)19-14-7)5-12-3-4-16-6-10(11(17)18)13-15-16/h6,12H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | VNSXYWKLTCMPPN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|