C26H28FN3O2S — CID 42276702
N-[3-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]piperidin-1-yl]phenyl]-4-fluorobenzenesulfonamide (PubChem CID 42276702) has the molecular formula C26H28FN3O2S and a molecular weight of 465.59 g/mol. Its IUPAC name is N-[3-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]piperidin-1-yl]phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]piperidin-1-yl]phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 42276702 |
| Molecular Formula | C26H28FN3O2S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[3-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]piperidin-1-yl]phenyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(N2CCC(N[C@H]3CCc4ccccc43)CC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28FN3O2S/c27-20-9-11-24(12-10-20)33(31,32)29-22-5-3-6-23(18-22)30-16-14-21(15-17-30)28-26-13-8-19-4-1-2-7-25(19)26/h1-7,9-12,18,21,26,28-29H,8,13-17H2/t26-/m0/s1 |
| InChIKey | AEZGUINLRULHBD-SANMLTNESA-N |
| XLogP | 4.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_H(6)', 'substructure': 'N/A'} |
|---|