C27H29N5O4 — CID 42277682
2-(methoxymethyl)-3-methyl-6-[(2-phenylacetyl)amino]-N-(3-pyridin-3-yloxypropyl)benzimidazole-4-carboxamide (PubChem CID 42277682) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-(methoxymethyl)-3-methyl-6-[(2-phenylacetyl)amino]-N-(3-pyridin-3-yloxypropyl)benzimidazole-4-carboxamide.
| Compound Name | 2-(methoxymethyl)-3-methyl-6-[(2-phenylacetyl)amino]-N-(3-pyridin-3-yloxypropyl)benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 42277682 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 2-(methoxymethyl)-3-methyl-6-[(2-phenylacetyl)amino]-N-(3-pyridin-3-yloxypropyl)benzimidazole-4-carboxamide |
| SMILES | COCc1nc2cc(NC(=O)Cc3ccccc3)cc(C(=O)NCCCOc3cccnc3)c2n1C |
| InChI | InChI=1S/C27H29N5O4/c1-32-24(18-35-2)31-23-16-20(30-25(33)14-19-8-4-3-5-9-19)15-22(26(23)32)27(34)29-12-7-13-36-21-10-6-11-28-17-21/h3-6,8-11,15-17H,7,12-14,18H2,1-2H3,(H,29,34)(H,30,33) |
| InChIKey | ZJKOJLCEEUKXQD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|