C27H29N5O3 — CID 42482087
7-[(2-methoxyacetyl)amino]-1-(2-phenylethyl)-N-(3-pyridin-3-ylpropyl)benzimidazole-5-carboxamide (PubChem CID 42482087) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 7-[(2-methoxyacetyl)amino]-1-(2-phenylethyl)-N-(3-pyridin-3-ylpropyl)benzimidazole-5-carboxamide.
| Compound Name | 7-[(2-methoxyacetyl)amino]-1-(2-phenylethyl)-N-(3-pyridin-3-ylpropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 42482087 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 7-[(2-methoxyacetyl)amino]-1-(2-phenylethyl)-N-(3-pyridin-3-ylpropyl)benzimidazole-5-carboxamide |
| SMILES | COCC(=O)Nc1cc(C(=O)NCCCc2cccnc2)cc2ncn(CCc3ccccc3)c12 |
| InChI | InChI=1S/C27H29N5O3/c1-35-18-25(33)31-24-16-22(27(34)29-13-6-10-21-9-5-12-28-17-21)15-23-26(24)32(19-30-23)14-11-20-7-3-2-4-8-20/h2-5,7-9,12,15-17,19H,6,10-11,13-14,18H2,1H3,(H,29,34)(H,31,33) |
| InChIKey | MDWLOQYXANHEGN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|