C23H24ClN5O4 — CID 42278979
5-chloro-N-(3,4-dimethylphenyl)-2-[2-[(2R)-2-(2-methoxyphenoxy)propanoyl]hydrazinyl]pyrimidine-4-carboxamide (PubChem CID 42278979) has the molecular formula C23H24ClN5O4 and a molecular weight of 469.93 g/mol. Its IUPAC name is 5-chloro-N-(3,4-dimethylphenyl)-2-[2-[(2R)-2-(2-methoxyphenoxy)propanoyl]hydrazinyl]pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(3,4-dimethylphenyl)-2-[2-[(2R)-2-(2-methoxyphenoxy)propanoyl]hydrazinyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 42278979 |
| Molecular Formula | C23H24ClN5O4 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 5-chloro-N-(3,4-dimethylphenyl)-2-[2-[(2R)-2-(2-methoxyphenoxy)propanoyl]hydrazinyl]pyrimidine-4-carboxamide |
| SMILES | COc1ccccc1O[C@H](C)C(=O)NNc1ncc(Cl)c(C(=O)Nc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C23H24ClN5O4/c1-13-9-10-16(11-14(13)2)26-22(31)20-17(24)12-25-23(27-20)29-28-21(30)15(3)33-19-8-6-5-7-18(19)32-4/h5-12,15H,1-4H3,(H,26,31)(H,28,30)(H,25,27,29)/t15-/m1/s1 |
| InChIKey | OXXPHFAIJILFLQ-OAHLLOKOSA-N |
| XLogP | 3.92 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|