C30H32N2O2 — CID 4228098
3-(4-benzylpiperidin-1-yl)-1-(2,2-diphenylethyl)pyrrolidine-2,5-dione (PubChem CID 4228098) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-1-(2,2-diphenylethyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-1-(2,2-diphenylethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4228098 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-1-(2,2-diphenylethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCC(Cc3ccccc3)CC2)C(=O)N1CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O2/c33-29-21-28(31-18-16-24(17-19-31)20-23-10-4-1-5-11-23)30(34)32(29)22-27(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,24,27-28H,16-22H2 |
| InChIKey | UTBWRNDPDWQQFY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|