C24H26N2O4 — CID 43861089
2-[4-[3-(4-benzylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]phenyl]acetic acid (PubChem CID 43861089) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[4-[3-(4-benzylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[3-(4-benzylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 43861089 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[4-[3-(4-benzylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(N2C(=O)CC(N3CCC(Cc4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H26N2O4/c27-22-16-21(24(30)26(22)20-8-6-18(7-9-20)15-23(28)29)25-12-10-19(11-13-25)14-17-4-2-1-3-5-17/h1-9,19,21H,10-16H2,(H,28,29) |
| InChIKey | YYCYOUIDVAGPCI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|