C23H24N4O4 — CID 8001406
methyl 1-[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]piperidine-4-carboxylate (PubChem CID 8001406) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl 1-[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8001406 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl 1-[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN([C@@H]2CC(=O)N(c3ccc(/N=N/c4ccccc4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C23H24N4O4/c1-31-23(30)16-11-13-26(14-12-16)20-15-21(28)27(22(20)29)19-9-7-18(8-10-19)25-24-17-5-3-2-4-6-17/h2-10,16,20H,11-15H2,1H3/b25-24+/t20-/m1/s1 |
| InChIKey | RJYFEDGPEXZVEE-NZXNHFJFSA-N |
| XLogP | 3.62 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|