C47H49ClFNO5S — CID 4228490
naphthalen-2-yl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate (PubChem CID 4228490) has the molecular formula C47H49ClFNO5S and a molecular weight of 794.43 g/mol. Its IUPAC name is naphthalen-2-yl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate.
| Compound Name | naphthalen-2-yl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 4228490 |
| Molecular Formula | C47H49ClFNO5S |
| Molecular Weight | 794.43 g/mol |
| Exact Mass | 793.30 |
| IUPAC Name | naphthalen-2-yl N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)C(=O)Oc2ccc3ccccc3c2)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C47H49ClFNO5S/c1-31-8-6-22-46(2)41(38-19-15-32(26-35(51)17-14-31)27-39(38)44(52)29-40-42(48)12-5-13-43(40)49)20-23-47(46,54)30-50(24-21-37-11-7-25-56-37)45(53)55-36-18-16-33-9-3-4-10-34(33)28-36/h3-5,7-13,15-16,18-19,25,27-28,35,41,51,54H,6,14,17,20-24,26,29-30H2,1-2H3 |
| InChIKey | LBTUKUYGTMMNEW-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.43 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|