C32H29ClFN3O8 — CID 4230978
8-(3-chloro-4-fluorophenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 4230978) has the molecular formula C32H29ClFN3O8 and a molecular weight of 638.05 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4230978 |
| Molecular Formula | C32H29ClFN3O8 |
| Molecular Weight | 638.05 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(C(N)=O)C(=O)C4C3CC3C(=O)N(c4ccc(F)c(Cl)c4)C(=O)C23C)cc(OC)c1O |
| InChI | InChI=1S/C32H29ClFN3O8/c1-32-19(8-4-14-10-23(44-2)26(38)24(11-14)45-3)16-6-7-17-25(29(41)37(27(17)39)31(35)43)18(16)13-20(32)28(40)36(30(32)42)15-5-9-22(34)21(33)12-15/h4-6,8-12,17-20,25,38H,7,13H2,1-3H3,(H2,35,43) |
| InChIKey | HHMRSFCZCYTYBF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 156.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.05 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|