C20H23N5O3S — CID 42321320
N-[3-[4-(pyrrolidine-1-carbonyl)triazol-1-yl]propyl]naphthalene-2-sulfonamide (PubChem CID 42321320) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[3-[4-(pyrrolidine-1-carbonyl)triazol-1-yl]propyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-[4-(pyrrolidine-1-carbonyl)triazol-1-yl]propyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 42321320 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[3-[4-(pyrrolidine-1-carbonyl)triazol-1-yl]propyl]naphthalene-2-sulfonamide |
| SMILES | O=C(c1cn(CCCNS(=O)(=O)c2ccc3ccccc3c2)nn1)N1CCCC1 |
| InChI | InChI=1S/C20H23N5O3S/c26-20(24-11-3-4-12-24)19-15-25(23-22-19)13-5-10-21-29(27,28)18-9-8-16-6-1-2-7-17(16)14-18/h1-2,6-9,14-15,21H,3-5,10-13H2 |
| InChIKey | VEQFLPNASLSSLO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|