C18H25N3O4S — CID 4233657
N-[cyclohexyl(4-hydroxybutyl)carbamothioyl]-3-nitrobenzamide (PubChem CID 4233657) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[cyclohexyl(4-hydroxybutyl)carbamothioyl]-3-nitrobenzamide.
| Compound Name | N-[cyclohexyl(4-hydroxybutyl)carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4233657 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[cyclohexyl(4-hydroxybutyl)carbamothioyl]-3-nitrobenzamide |
| SMILES | O=C(NC(=S)N(CCCCO)C1CCCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H25N3O4S/c22-12-5-4-11-20(15-8-2-1-3-9-15)18(26)19-17(23)14-7-6-10-16(13-14)21(24)25/h6-7,10,13,15,22H,1-5,8-9,11-12H2,(H,19,23,26) |
| InChIKey | DJQFZZVYEBAQFE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|