C18H23N3O4S — CID 1256159
N-[cyclobutylmethyl-[[(2R)-oxolan-2-yl]methyl]carbamothioyl]-3-nitrobenzamide (PubChem CID 1256159) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[cyclobutylmethyl-[[(2R)-oxolan-2-yl]methyl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | N-[cyclobutylmethyl-[[(2R)-oxolan-2-yl]methyl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1256159 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[cyclobutylmethyl-[[(2R)-oxolan-2-yl]methyl]carbamothioyl]-3-nitrobenzamide |
| SMILES | O=C(NC(=S)N(CC1CCC1)C[C@H]1CCCO1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H23N3O4S/c22-17(14-6-2-7-15(10-14)21(23)24)19-18(26)20(11-13-4-1-5-13)12-16-8-3-9-25-16/h2,6-7,10,13,16H,1,3-5,8-9,11-12H2,(H,19,22,26)/t16-/m1/s1 |
| InChIKey | LNAUEMNSCSWIKP-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|