C16H21IN2O3S — CID 2967910
N-[ethyl(oxolan-2-ylmethyl)carbamothioyl]-3-iodo-4-methoxybenzamide (PubChem CID 2967910) has the molecular formula C16H21IN2O3S and a molecular weight of 448.33 g/mol. Its IUPAC name is N-[ethyl(oxolan-2-ylmethyl)carbamothioyl]-3-iodo-4-methoxybenzamide.
| Compound Name | N-[ethyl(oxolan-2-ylmethyl)carbamothioyl]-3-iodo-4-methoxybenzamide |
|---|---|
| PubChem CID | 2967910 |
| Molecular Formula | C16H21IN2O3S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | N-[ethyl(oxolan-2-ylmethyl)carbamothioyl]-3-iodo-4-methoxybenzamide |
| SMILES | CCN(CC1CCCO1)C(=S)NC(=O)c1ccc(OC)c(I)c1 |
| InChI | InChI=1S/C16H21IN2O3S/c1-3-19(10-12-5-4-8-22-12)16(23)18-15(20)11-6-7-14(21-2)13(17)9-11/h6-7,9,12H,3-5,8,10H2,1-2H3,(H,18,20,23) |
| InChIKey | PQLDAXFLQTWNQN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|