C23H26IN3O3S — CID 4929534
N-[[2-(cyclohexylcarbamoyl)phenyl]-methylcarbamothioyl]-3-iodo-4-methoxybenzamide (PubChem CID 4929534) has the molecular formula C23H26IN3O3S and a molecular weight of 551.45 g/mol. Its IUPAC name is N-[[2-(cyclohexylcarbamoyl)phenyl]-methylcarbamothioyl]-3-iodo-4-methoxybenzamide.
| Compound Name | N-[[2-(cyclohexylcarbamoyl)phenyl]-methylcarbamothioyl]-3-iodo-4-methoxybenzamide |
|---|---|
| PubChem CID | 4929534 |
| Molecular Formula | C23H26IN3O3S |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | N-[[2-(cyclohexylcarbamoyl)phenyl]-methylcarbamothioyl]-3-iodo-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)N(C)c2ccccc2C(=O)NC2CCCCC2)cc1I |
| InChI | InChI=1S/C23H26IN3O3S/c1-27(23(31)26-21(28)15-12-13-20(30-2)18(24)14-15)19-11-7-6-10-17(19)22(29)25-16-8-4-3-5-9-16/h6-7,10-14,16H,3-5,8-9H2,1-2H3,(H,25,29)(H,26,28,31) |
| InChIKey | CZDNYPJEQLQAOF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|