C28H29N3O2S — CID 6233422
N-cyclohexyl-2-[methyl-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioyl]amino]benzamide (PubChem CID 6233422) has the molecular formula C28H29N3O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is N-cyclohexyl-2-[methyl-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioyl]amino]benzamide.
| Compound Name | N-cyclohexyl-2-[methyl-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioyl]amino]benzamide |
|---|---|
| PubChem CID | 6233422 |
| Molecular Formula | C28H29N3O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-cyclohexyl-2-[methyl-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioyl]amino]benzamide |
| SMILES | CN(C(=S)NC(=O)/C=C/c1cccc2ccccc12)c1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H29N3O2S/c1-31(25-17-8-7-16-24(25)27(33)29-22-13-3-2-4-14-22)28(34)30-26(32)19-18-21-12-9-11-20-10-5-6-15-23(20)21/h5-12,15-19,22H,2-4,13-14H2,1H3,(H,29,33)(H,30,32,34)/b19-18+ |
| InChIKey | LAJRJKXAMNBYHN-VHEBQXMUSA-N |
| XLogP | 5.45 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|