C22H24IN3O2S — CID 4929502
N-cyclohexyl-2-[(2-iodobenzoyl)carbamothioyl-methylamino]benzamide (PubChem CID 4929502) has the molecular formula C22H24IN3O2S and a molecular weight of 521.42 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2-iodobenzoyl)carbamothioyl-methylamino]benzamide.
| Compound Name | N-cyclohexyl-2-[(2-iodobenzoyl)carbamothioyl-methylamino]benzamide |
|---|---|
| PubChem CID | 4929502 |
| Molecular Formula | C22H24IN3O2S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | N-cyclohexyl-2-[(2-iodobenzoyl)carbamothioyl-methylamino]benzamide |
| SMILES | CN(C(=S)NC(=O)c1ccccc1I)c1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H24IN3O2S/c1-26(22(29)25-20(27)16-11-5-7-13-18(16)23)19-14-8-6-12-17(19)21(28)24-15-9-3-2-4-10-15/h5-8,11-15H,2-4,9-10H2,1H3,(H,24,28)(H,25,27,29) |
| InChIKey | JMUXQYFDDILJSJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|