C23H26BrN3O2S — CID 4929540
3-bromo-N-[[2-(cyclohexylcarbamoyl)phenyl]-methylcarbamothioyl]-4-methylbenzamide (PubChem CID 4929540) has the molecular formula C23H26BrN3O2S and a molecular weight of 488.45 g/mol. Its IUPAC name is 3-bromo-N-[[2-(cyclohexylcarbamoyl)phenyl]-methylcarbamothioyl]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[[2-(cyclohexylcarbamoyl)phenyl]-methylcarbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 4929540 |
| Molecular Formula | C23H26BrN3O2S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 3-bromo-N-[[2-(cyclohexylcarbamoyl)phenyl]-methylcarbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)N(C)c2ccccc2C(=O)NC2CCCCC2)cc1Br |
| InChI | InChI=1S/C23H26BrN3O2S/c1-15-12-13-16(14-19(15)24)21(28)26-23(30)27(2)20-11-7-6-10-18(20)22(29)25-17-8-4-3-5-9-17/h6-7,10-14,17H,3-5,8-9H2,1-2H3,(H,25,29)(H,26,28,30) |
| InChIKey | IYQMRGWTQSSPBH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|