C22H27N3O4S — CID 42348312
1-benzyl-N-(2,2-diethoxyethyl)-3-phenylpyrazole-4-sulfonamide (PubChem CID 42348312) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-benzyl-N-(2,2-diethoxyethyl)-3-phenylpyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-N-(2,2-diethoxyethyl)-3-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42348312 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-benzyl-N-(2,2-diethoxyethyl)-3-phenylpyrazole-4-sulfonamide |
| SMILES | CCOC(CNS(=O)(=O)c1cn(Cc2ccccc2)nc1-c1ccccc1)OCC |
| InChI | InChI=1S/C22H27N3O4S/c1-3-28-21(29-4-2)15-23-30(26,27)20-17-25(16-18-11-7-5-8-12-18)24-22(20)19-13-9-6-10-14-19/h5-14,17,21,23H,3-4,15-16H2,1-2H3 |
| InChIKey | QKKMSXUWLGPCHC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|