C22H17F3N2O4 — CID 42349122
1-oxido-N-[[(2R)-5-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1-benzofuran-2-yl]methyl]pyridin-1-ium-4-carboxamide (PubChem CID 42349122) has the molecular formula C22H17F3N2O4 and a molecular weight of 430.38 g/mol. Its IUPAC name is 1-oxido-N-[[(2R)-5-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1-benzofuran-2-yl]methyl]pyridin-1-ium-4-carboxamide.
| Compound Name | 1-oxido-N-[[(2R)-5-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1-benzofuran-2-yl]methyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 42349122 |
| Molecular Formula | C22H17F3N2O4 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 1-oxido-N-[[(2R)-5-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1-benzofuran-2-yl]methyl]pyridin-1-ium-4-carboxamide |
| SMILES | O=C(NC[C@H]1Cc2cc(-c3cccc(OC(F)(F)F)c3)ccc2O1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C22H17F3N2O4/c23-22(24,25)31-18-3-1-2-15(11-18)16-4-5-20-17(10-16)12-19(30-20)13-26-21(28)14-6-8-27(29)9-7-14/h1-11,19H,12-13H2,(H,26,28)/t19-/m1/s1 |
| InChIKey | CABOFJFSONLXQK-LJQANCHMSA-N |
| XLogP | 3.62 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|