C22H19N3O3 — CID 97352135
1-oxido-N-[[(5S)-3-(4-phenylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyridin-1-ium-4-carboxamide (PubChem CID 97352135) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-oxido-N-[[(5S)-3-(4-phenylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyridin-1-ium-4-carboxamide.
| Compound Name | 1-oxido-N-[[(5S)-3-(4-phenylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 97352135 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-oxido-N-[[(5S)-3-(4-phenylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyridin-1-ium-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CC(c2ccc(-c3ccccc3)cc2)=NO1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C22H19N3O3/c26-22(19-10-12-25(27)13-11-19)23-15-20-14-21(24-28-20)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-13,20H,14-15H2,(H,23,26)/t20-/m0/s1 |
| InChIKey | OXESVJXXYQRSJO-FQEVSTJZSA-N |
| XLogP | 2.91 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|