C15H18F4N2O — CID 42356456
(4S)-1-[(3-fluorophenyl)methyl]-4-(4,4,4-trifluorobutylamino)pyrrolidin-2-one (PubChem CID 42356456) has the molecular formula C15H18F4N2O and a molecular weight of 318.31 g/mol. Its IUPAC name is (4S)-1-[(3-fluorophenyl)methyl]-4-(4,4,4-trifluorobutylamino)pyrrolidin-2-one.
| Compound Name | (4S)-1-[(3-fluorophenyl)methyl]-4-(4,4,4-trifluorobutylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 42356456 |
| Molecular Formula | C15H18F4N2O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (4S)-1-[(3-fluorophenyl)methyl]-4-(4,4,4-trifluorobutylamino)pyrrolidin-2-one |
| SMILES | O=C1C[C@H](NCCCC(F)(F)F)CN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H18F4N2O/c16-12-4-1-3-11(7-12)9-21-10-13(8-14(21)22)20-6-2-5-15(17,18)19/h1,3-4,7,13,20H,2,5-6,8-10H2/t13-/m0/s1 |
| InChIKey | SYZBNEBMJSERNY-ZDUSSCGKSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|