C27H32FN3O — CID 42359710
1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[[7-fluoro-2-(3-methoxyphenyl)quinolin-3-yl]methyl]methanamine (PubChem CID 42359710) has the molecular formula C27H32FN3O and a molecular weight of 433.57 g/mol. Its IUPAC name is 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[[7-fluoro-2-(3-methoxyphenyl)quinolin-3-yl]methyl]methanamine.
| Compound Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[[7-fluoro-2-(3-methoxyphenyl)quinolin-3-yl]methyl]methanamine |
|---|---|
| PubChem CID | 42359710 |
| Molecular Formula | C27H32FN3O |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[[7-fluoro-2-(3-methoxyphenyl)quinolin-3-yl]methyl]methanamine |
| SMILES | COc1cccc(-c2nc3cc(F)ccc3cc2CNC[C@@H]2CCCN3CCCC[C@H]23)c1 |
| InChI | InChI=1S/C27H32FN3O/c1-32-24-8-4-6-20(15-24)27-22(14-19-10-11-23(28)16-25(19)30-27)18-29-17-21-7-5-13-31-12-3-2-9-26(21)31/h4,6,8,10-11,14-16,21,26,29H,2-3,5,7,9,12-13,17-18H2,1H3/t21-,26+/m0/s1 |
| InChIKey | GCMXMJWVWVJHDW-HFZDXXHNSA-N |
| XLogP | 5.40 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |