C22H31ClN4 — CID 42160252
2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[[3-(3-chlorophenyl)-1-methylpyrazol-4-yl]methyl]ethanamine (PubChem CID 42160252) has the molecular formula C22H31ClN4 and a molecular weight of 386.97 g/mol. Its IUPAC name is 2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[[3-(3-chlorophenyl)-1-methylpyrazol-4-yl]methyl]ethanamine.
| Compound Name | 2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[[3-(3-chlorophenyl)-1-methylpyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 42160252 |
| Molecular Formula | C22H31ClN4 |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[[3-(3-chlorophenyl)-1-methylpyrazol-4-yl]methyl]ethanamine |
| SMILES | Cn1cc(CNCC[C@@H]2CCCN3CCCC[C@H]23)c(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C22H31ClN4/c1-26-16-19(22(25-26)18-6-4-8-20(23)14-18)15-24-11-10-17-7-5-13-27-12-3-2-9-21(17)27/h4,6,8,14,16-17,21,24H,2-3,5,7,9-13,15H2,1H3/t17-,21+/m0/s1 |
| InChIKey | BUZUTCVGFIUBQF-LAUBAEHRSA-N |
| XLogP | 4.48 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|