C19H24ClN3O2 — CID 42384150
ethyl (3S)-1-[[3-(3-chlorophenyl)-1-methylpyrazol-4-yl]methyl]piperidine-3-carboxylate (PubChem CID 42384150) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is ethyl (3S)-1-[[3-(3-chlorophenyl)-1-methylpyrazol-4-yl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[[3-(3-chlorophenyl)-1-methylpyrazol-4-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42384150 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | ethyl (3S)-1-[[3-(3-chlorophenyl)-1-methylpyrazol-4-yl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(Cc2cn(C)nc2-c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-3-25-19(24)15-7-5-9-23(12-15)13-16-11-22(2)21-18(16)14-6-4-8-17(20)10-14/h4,6,8,10-11,15H,3,5,7,9,12-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | OWZMEYWVMDILHW-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |