C14H18F2N2O — CID 42366284
1-[(3,4-difluorophenyl)methyl]-4-ethyl-1,4-diazepan-5-one (PubChem CID 42366284) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-4-ethyl-1,4-diazepan-5-one.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-4-ethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42366284 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-4-ethyl-1,4-diazepan-5-one |
| SMILES | CCN1CCN(Cc2ccc(F)c(F)c2)CCC1=O |
| InChI | InChI=1S/C14H18F2N2O/c1-2-18-8-7-17(6-5-14(18)19)10-11-3-4-12(15)13(16)9-11/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | CDDOBLGNHQGRHY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |