C19H26N2O2 — CID 118757642
4-ethyl-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one (PubChem CID 118757642) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-ethyl-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one.
| Compound Name | 4-ethyl-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 118757642 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 4-ethyl-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one |
| SMILES | CCN1CCN(Cc2ccc(C#CC(C)(C)O)cc2)CCC1=O |
| InChI | InChI=1S/C19H26N2O2/c1-4-21-14-13-20(12-10-18(21)22)15-17-7-5-16(6-8-17)9-11-19(2,3)23/h5-8,23H,4,10,12-15H2,1-3H3 |
| InChIKey | ORFCSTJXGUEHHP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|