C19H23N5O2 — CID 77098299
[4-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]piperazin-1-yl]-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 77098299) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is [4-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]piperazin-1-yl]-(1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | [4-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]piperazin-1-yl]-(1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 77098299 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | [4-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]piperazin-1-yl]-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | CC(C)(O)C#Cc1ccc(CN2CCN(C(=O)c3ncn[nH]3)CC2)cc1 |
| InChI | InChI=1S/C19H23N5O2/c1-19(2,26)8-7-15-3-5-16(6-4-15)13-23-9-11-24(12-10-23)18(25)17-20-14-21-22-17/h3-6,14,26H,9-13H2,1-2H3,(H,20,21,22) |
| InChIKey | JAIFBEKXOQWPCW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|