C19H22N2O3 — CID 74233411
(3aS,6aR)-5-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione (PubChem CID 74233411) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (3aS,6aR)-5-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione.
| Compound Name | (3aS,6aR)-5-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 74233411 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (3aS,6aR)-5-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
| SMILES | CN1C(=O)[C@H]2CN(Cc3ccc(C#CC(C)(C)O)cc3)C[C@H]2C1=O |
| InChI | InChI=1S/C19H22N2O3/c1-19(2,24)9-8-13-4-6-14(7-5-13)10-21-11-15-16(12-21)18(23)20(3)17(15)22/h4-7,15-16,24H,10-12H2,1-3H3/t15-,16+ |
| InChIKey | ZJWFDSHMWNCNDZ-IYBDPMFKSA-N |
| XLogP | 0.86 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|