C27H22N2O5 — CID 42384931
[2-(2-benzoylanilino)-2-oxoethyl] 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate (PubChem CID 42384931) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is [2-(2-benzoylanilino)-2-oxoethyl] 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2-benzoylanilino)-2-oxoethyl] 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 42384931 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [2-(2-benzoylanilino)-2-oxoethyl] 3-(1-methylidene-3-oxoisoindol-2-yl)propanoate |
| SMILES | C=C1c2ccccc2C(=O)N1CCC(=O)OCC(=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H22N2O5/c1-18-20-11-5-6-12-21(20)27(33)29(18)16-15-25(31)34-17-24(30)28-23-14-8-7-13-22(23)26(32)19-9-3-2-4-10-19/h2-14H,1,15-17H2,(H,28,30) |
| InChIKey | NRUZKEQZADHEEB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |