C18H18N2O3S — CID 42398192
3-[(6-thiophen-3-yl-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylamino]propan-1-ol (PubChem CID 42398192) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-[(6-thiophen-3-yl-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylamino]propan-1-ol.
| Compound Name | 3-[(6-thiophen-3-yl-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 42398192 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-[(6-thiophen-3-yl-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylamino]propan-1-ol |
| SMILES | OCCCNCc1cc2cc3c(cc2nc1-c1ccsc1)OCO3 |
| InChI | InChI=1S/C18H18N2O3S/c21-4-1-3-19-9-14-6-13-7-16-17(23-11-22-16)8-15(13)20-18(14)12-2-5-24-10-12/h2,5-8,10,19,21H,1,3-4,9,11H2 |
| InChIKey | ITXLYIURLGIICP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|