C22H19ClN4O4 — CID 4241909
1-[3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 4241909) has the molecular formula C22H19ClN4O4 and a molecular weight of 438.87 g/mol. Its IUPAC name is 1-[3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-[3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4241909 |
| Molecular Formula | C22H19ClN4O4 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-[3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])cc1)N1CCCC(c2nc(-c3cccc(Cl)c3)no2)C1 |
| InChI | InChI=1S/C22H19ClN4O4/c23-18-5-1-3-16(13-18)21-24-22(31-25-21)17-4-2-12-26(14-17)20(28)11-8-15-6-9-19(10-7-15)27(29)30/h1,3,5-11,13,17H,2,4,12,14H2 |
| InChIKey | YJVBJYYYNRSGFB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|