C18H15FN2O4S — CID 42426597
ethyl 3-[[(5R)-3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate (PubChem CID 42426597) has the molecular formula C18H15FN2O4S and a molecular weight of 374.39 g/mol. Its IUPAC name is ethyl 3-[[(5R)-3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate.
| Compound Name | ethyl 3-[[(5R)-3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 42426597 |
| Molecular Formula | C18H15FN2O4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | ethyl 3-[[(5R)-3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(N[C@@H]2SC(=O)N(c3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C18H15FN2O4S/c1-2-25-17(23)11-4-3-5-13(10-11)20-15-16(22)21(18(24)26-15)14-8-6-12(19)7-9-14/h3-10,15,20H,2H2,1H3/t15-/m1/s1 |
| InChIKey | SONZDLLZYDQNPY-OAHLLOKOSA-N |
| XLogP | 3.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|