C21H25F2N3 — CID 42431475
(3S)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidine (PubChem CID 42431475) has the molecular formula C21H25F2N3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (3S)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidine.
| Compound Name | (3S)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidine |
|---|---|
| PubChem CID | 42431475 |
| Molecular Formula | C21H25F2N3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (3S)-1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-[4-(3,4-difluorophenyl)-1H-pyrazol-5-yl]piperidine |
| SMILES | Fc1ccc(-c2cn[nH]c2[C@H]2CCCN(C[C@H]3CC=CCC3)C2)cc1F |
| InChI | InChI=1S/C21H25F2N3/c22-19-9-8-16(11-20(19)23)18-12-24-25-21(18)17-7-4-10-26(14-17)13-15-5-2-1-3-6-15/h1-2,8-9,11-12,15,17H,3-7,10,13-14H2,(H,24,25)/t15-,17-/m0/s1 |
| InChIKey | UVADPZQJHLGRKV-RDJZCZTQSA-N |
| XLogP | 4.89 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|