C18H29N3 — CID 99937812
(3R)-1-[[(1S)-cyclohex-3-en-1-yl]methyl]-3-(4-propan-2-yl-1H-pyrazol-5-yl)piperidine (PubChem CID 99937812) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is (3R)-1-[[(1S)-cyclohex-3-en-1-yl]methyl]-3-(4-propan-2-yl-1H-pyrazol-5-yl)piperidine.
| Compound Name | (3R)-1-[[(1S)-cyclohex-3-en-1-yl]methyl]-3-(4-propan-2-yl-1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 99937812 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (3R)-1-[[(1S)-cyclohex-3-en-1-yl]methyl]-3-(4-propan-2-yl-1H-pyrazol-5-yl)piperidine |
| SMILES | CC(C)c1cn[nH]c1[C@@H]1CCCN(C[C@@H]2CC=CCC2)C1 |
| InChI | InChI=1S/C18H29N3/c1-14(2)17-11-19-20-18(17)16-9-6-10-21(13-16)12-15-7-4-3-5-8-15/h3-4,11,14-16H,5-10,12-13H2,1-2H3,(H,19,20)/t15-,16-/m1/s1 |
| InChIKey | AXTVOJQPJPOJAS-HZPDHXFCSA-N |
| XLogP | 4.07 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|