C27H32FN5O — CID 42431836
N-[4-[4-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylamino]piperidin-1-yl]phenyl]cyclopentanecarboxamide (PubChem CID 42431836) has the molecular formula C27H32FN5O and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[4-[4-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylamino]piperidin-1-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[4-[4-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylamino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42431836 |
| Molecular Formula | C27H32FN5O |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | N-[4-[4-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylamino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(NCc3cn[nH]c3-c3ccc(F)cc3)CC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C27H32FN5O/c28-22-7-5-19(6-8-22)26-21(18-30-32-26)17-29-23-13-15-33(16-14-23)25-11-9-24(10-12-25)31-27(34)20-3-1-2-4-20/h5-12,18,20,23,29H,1-4,13-17H2,(H,30,32)(H,31,34) |
| InChIKey | OUFIDAOPKMZWMZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|