C28H39N5O2 — CID 45233500
N-[4-[4-[(2-morpholin-4-yl-2-pyridin-4-ylethyl)amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide (PubChem CID 45233500) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[4-[4-[(2-morpholin-4-yl-2-pyridin-4-ylethyl)amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[4-[4-[(2-morpholin-4-yl-2-pyridin-4-ylethyl)amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 45233500 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | N-[4-[4-[(2-morpholin-4-yl-2-pyridin-4-ylethyl)amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(NCC(c3ccncc3)N3CCOCC3)CC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C28H39N5O2/c34-28(23-3-1-2-4-23)31-25-5-7-26(8-6-25)32-15-11-24(12-16-32)30-21-27(22-9-13-29-14-10-22)33-17-19-35-20-18-33/h5-10,13-14,23-24,27,30H,1-4,11-12,15-21H2,(H,31,34) |
| InChIKey | CFVXGJVBASQAFN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|