C29H33ClN4O — CID 45203516
N-[4-[4-[[(4-chlorophenyl)-pyridin-4-ylmethyl]amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide (PubChem CID 45203516) has the molecular formula C29H33ClN4O and a molecular weight of 489.06 g/mol. Its IUPAC name is N-[4-[4-[[(4-chlorophenyl)-pyridin-4-ylmethyl]amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[4-[4-[[(4-chlorophenyl)-pyridin-4-ylmethyl]amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 45203516 |
| Molecular Formula | C29H33ClN4O |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[4-[4-[[(4-chlorophenyl)-pyridin-4-ylmethyl]amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(NC(c3ccncc3)c3ccc(Cl)cc3)CC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C29H33ClN4O/c30-24-7-5-21(6-8-24)28(22-13-17-31-18-14-22)32-26-15-19-34(20-16-26)27-11-9-25(10-12-27)33-29(35)23-3-1-2-4-23/h5-14,17-18,23,26,28,32H,1-4,15-16,19-20H2,(H,33,35) |
| InChIKey | WLOMLXCZAOHSIK-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|