C24H29F3N4O — CID 45249951
N-[4-[4-[(2,2,2-trifluoro-1-pyridin-2-ylethyl)amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide (PubChem CID 45249951) has the molecular formula C24H29F3N4O and a molecular weight of 446.52 g/mol. Its IUPAC name is N-[4-[4-[(2,2,2-trifluoro-1-pyridin-2-ylethyl)amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[4-[4-[(2,2,2-trifluoro-1-pyridin-2-ylethyl)amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 45249951 |
| Molecular Formula | C24H29F3N4O |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N-[4-[4-[(2,2,2-trifluoro-1-pyridin-2-ylethyl)amino]piperidin-1-yl]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(NC(c3ccccn3)C(F)(F)F)CC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C24H29F3N4O/c25-24(26,27)22(21-7-3-4-14-28-21)29-19-12-15-31(16-13-19)20-10-8-18(9-11-20)30-23(32)17-5-1-2-6-17/h3-4,7-11,14,17,19,22,29H,1-2,5-6,12-13,15-16H2,(H,30,32) |
| InChIKey | YGACAGCCHMZLDW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|