C21H37N3O3S — CID 42455147
1-[[2-(cyclohexylmethylsulfonyl)-3-(2-methoxyethyl)imidazol-4-yl]methyl]azocane (PubChem CID 42455147) has the molecular formula C21H37N3O3S and a molecular weight of 411.61 g/mol. Its IUPAC name is 1-[[2-(cyclohexylmethylsulfonyl)-3-(2-methoxyethyl)imidazol-4-yl]methyl]azocane.
| Compound Name | 1-[[2-(cyclohexylmethylsulfonyl)-3-(2-methoxyethyl)imidazol-4-yl]methyl]azocane |
|---|---|
| PubChem CID | 42455147 |
| Molecular Formula | C21H37N3O3S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 1-[[2-(cyclohexylmethylsulfonyl)-3-(2-methoxyethyl)imidazol-4-yl]methyl]azocane |
| SMILES | COCCn1c(CN2CCCCCCC2)cnc1S(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C21H37N3O3S/c1-27-15-14-24-20(17-23-12-8-3-2-4-9-13-23)16-22-21(24)28(25,26)18-19-10-6-5-7-11-19/h16,19H,2-15,17-18H2,1H3 |
| InChIKey | VSOVXQQFXWQZPE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |