C25H20Cl2FNO2S — CID 4245721
2-chloro-N-[1-(2-chlorophenyl)-2-oxo-3-(thiophen-2-ylmethylidene)cyclohexyl]-6-fluoro-N-methylbenzamide (PubChem CID 4245721) has the molecular formula C25H20Cl2FNO2S and a molecular weight of 488.41 g/mol. Its IUPAC name is 2-chloro-N-[1-(2-chlorophenyl)-2-oxo-3-(thiophen-2-ylmethylidene)cyclohexyl]-6-fluoro-N-methylbenzamide.
| Compound Name | 2-chloro-N-[1-(2-chlorophenyl)-2-oxo-3-(thiophen-2-ylmethylidene)cyclohexyl]-6-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 4245721 |
| Molecular Formula | C25H20Cl2FNO2S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 2-chloro-N-[1-(2-chlorophenyl)-2-oxo-3-(thiophen-2-ylmethylidene)cyclohexyl]-6-fluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1c(F)cccc1Cl)C1(c2ccccc2Cl)CCCC(=Cc2cccs2)C1=O |
| InChI | InChI=1S/C25H20Cl2FNO2S/c1-29(24(31)22-20(27)11-4-12-21(22)28)25(18-9-2-3-10-19(18)26)13-5-7-16(23(25)30)15-17-8-6-14-32-17/h2-4,6,8-12,14-15H,5,7,13H2,1H3 |
| InChIKey | ZUEXUUCCGBCUSC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|