C24H25ClN4O2 — CID 42471194
(E)-3-(2-chlorophenyl)-1-[4-[2-[(2R)-oxolan-2-yl]imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 42471194) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-[2-[(2R)-oxolan-2-yl]imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-[2-[(2R)-oxolan-2-yl]imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 42471194 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-[2-[(2R)-oxolan-2-yl]imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)N1CCC(n2c([C@H]3CCCO3)nc3cccnc32)CC1 |
| InChI | InChI=1S/C24H25ClN4O2/c25-19-6-2-1-5-17(19)9-10-22(30)28-14-11-18(12-15-28)29-23-20(7-3-13-26-23)27-24(29)21-8-4-16-31-21/h1-3,5-7,9-10,13,18,21H,4,8,11-12,14-16H2/b10-9+/t21-/m1/s1 |
| InChIKey | UBNNWHLVOPXJIX-LCCNJJIFSA-N |
| XLogP | 4.81 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|