C27H29N5O2 — CID 42471928
N-(3-imidazol-1-ylpropyl)-6-methyl-2-[(2-methylphenyl)methyl]-4-oxo-1-(pyridin-4-ylmethyl)pyridine-3-carboxamide (PubChem CID 42471928) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-6-methyl-2-[(2-methylphenyl)methyl]-4-oxo-1-(pyridin-4-ylmethyl)pyridine-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[(2-methylphenyl)methyl]-4-oxo-1-(pyridin-4-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42471928 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[(2-methylphenyl)methyl]-4-oxo-1-(pyridin-4-ylmethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccccc1Cc1c(C(=O)NCCCn2ccnc2)c(=O)cc(C)n1Cc1ccncc1 |
| InChI | InChI=1S/C27H29N5O2/c1-20-6-3-4-7-23(20)17-24-26(27(34)30-10-5-14-31-15-13-29-19-31)25(33)16-21(2)32(24)18-22-8-11-28-12-9-22/h3-4,6-9,11-13,15-16,19H,5,10,14,17-18H2,1-2H3,(H,30,34) |
| InChIKey | ODNGENIKTSDFTE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|