C26H33FN4O4 — CID 42472499
N-[(3-fluorophenyl)methyl]-9-methoxy-3-[(2S)-1-methylazepane-2-carbonyl]-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide (PubChem CID 42472499) has the molecular formula C26H33FN4O4 and a molecular weight of 484.57 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-9-methoxy-3-[(2S)-1-methylazepane-2-carbonyl]-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-9-methoxy-3-[(2S)-1-methylazepane-2-carbonyl]-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
|---|---|
| PubChem CID | 42472499 |
| Molecular Formula | C26H33FN4O4 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-9-methoxy-3-[(2S)-1-methylazepane-2-carbonyl]-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
| SMILES | COc1cc(=O)n2c(c1C(=O)NCc1cccc(F)c1)CCN(C(=O)[C@@H]1CCCCCN1C)CC2 |
| InChI | InChI=1S/C26H33FN4O4/c1-29-11-5-3-4-9-21(29)26(34)30-12-10-20-24(22(35-2)16-23(32)31(20)14-13-30)25(33)28-17-18-7-6-8-19(27)15-18/h6-8,15-16,21H,3-5,9-14,17H2,1-2H3,(H,28,33)/t21-/m0/s1 |
| InChIKey | QGHWRKMXVBVIQX-NRFANRHFSA-N |
| XLogP | 2.19 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |