C27H30FN3O3 — CID 42213639
N-[(3-fluorophenyl)methyl]-9-methoxy-7-oxo-3-(3-phenylpropyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide (PubChem CID 42213639) has the molecular formula C27H30FN3O3 and a molecular weight of 463.55 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-9-methoxy-7-oxo-3-(3-phenylpropyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-9-methoxy-7-oxo-3-(3-phenylpropyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
|---|---|
| PubChem CID | 42213639 |
| Molecular Formula | C27H30FN3O3 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-9-methoxy-7-oxo-3-(3-phenylpropyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
| SMILES | COc1cc(=O)n2c(c1C(=O)NCc1cccc(F)c1)CCN(CCCc1ccccc1)CC2 |
| InChI | InChI=1S/C27H30FN3O3/c1-34-24-18-25(32)31-16-15-30(13-6-10-20-7-3-2-4-8-20)14-12-23(31)26(24)27(33)29-19-21-9-5-11-22(28)17-21/h2-5,7-9,11,17-18H,6,10,12-16,19H2,1H3,(H,29,33) |
| InChIKey | SNPJLFREPMLUJW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |