C26H26FN3O4S — CID 26348089
N-[(3-fluorophenyl)methyl]-9-methoxy-3-(2-methylsulfanylbenzoyl)-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide (PubChem CID 26348089) has the molecular formula C26H26FN3O4S and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-9-methoxy-3-(2-methylsulfanylbenzoyl)-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-9-methoxy-3-(2-methylsulfanylbenzoyl)-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
|---|---|
| PubChem CID | 26348089 |
| Molecular Formula | C26H26FN3O4S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-9-methoxy-3-(2-methylsulfanylbenzoyl)-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxamide |
| SMILES | COc1cc(=O)n2c(c1C(=O)NCc1cccc(F)c1)CCN(C(=O)c1ccccc1SC)CC2 |
| InChI | InChI=1S/C26H26FN3O4S/c1-34-21-15-23(31)30-13-12-29(26(33)19-8-3-4-9-22(19)35-2)11-10-20(30)24(21)25(32)28-16-17-6-5-7-18(27)14-17/h3-9,14-15H,10-13,16H2,1-2H3,(H,28,32) |
| InChIKey | MAZKQHUCQWFHKB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |